SB-242084

File:SB242084.png

SB242084.png

{{Infobox drug | image = | width = | alt = | caption = | IUPAC name = 6-Chloro-5-methyl-1-[[2-(2-methylpyridin-3-yloxy)ethyl]oxy]-2,3-dihydro-1H-indole | CAS number = 181632-25-9 | ATC prefix = | ATC suffix = | PubChem = 5311277 | ChemSpiderID = 4470904 | UNII = 0T493YFU8O | KEGG = D05966 | ChEMBL = 123187 | C=17 | H=20 | Cl=1 | N=1 | O=2 | molecular weight = 305.8 | smiles = CC1=CC=NC(=C1)OCCOC2=CC3=C(C=C2Cl)N(CC3)C | StdInChI = 1S/C17H20ClNO2/c1-11-4-5-19-17(8-11)21-9-10-20-14-6-7-15-13(12(14)2)3-16(18)22-15/h3-8H,9-10H2,1-2H3 | StdInChIKey = QXQXKJZQJXKJQF-UHFFFAOYSA-N }}

SB-242084 is a selective 5-HT2C receptor antagonist. It is commonly used in scientific research to investigate the role of the serotonin 2C receptor in various physiological and pathological processes.

Pharmacology[edit]

SB-242084 has been shown to have high affinity and selectivity for the 5-HT2C receptor, with significantly lower affinity for other serotonin receptors such as 5-HT2A and 5-HT2B. This selectivity makes it a valuable tool in research for distinguishing the specific effects mediated by the 5-HT2C receptor.

Research Applications[edit]

SB-242084 is used in a variety of research contexts, including studies on anxiety, depression, schizophrenia, and obesity. By blocking the 5-HT2C receptor, researchers can better understand the receptor's role in these conditions and potentially develop new therapeutic strategies.

Anxiety and Depression[edit]

Studies have shown that SB-242084 can produce anxiolytic and antidepressant-like effects in animal models. This suggests that the 5-HT2C receptor may play a role in the regulation of mood and anxiety, making it a potential target for new treatments.

Schizophrenia[edit]

Research indicates that the 5-HT2C receptor may be involved in the pathophysiology of schizophrenia. SB-242084 is used to explore this connection and to evaluate the potential of 5-HT2C receptor antagonists as antipsychotic agents.

Obesity[edit]

The 5-HT2C receptor is also implicated in the regulation of appetite and body weight. SB-242084 is used to study its role in these processes, with the aim of developing new treatments for obesity and related metabolic disorders.

Chemical Properties[edit]

SB-242084 has the chemical formula C17H20ClNO2 and a molecular weight of 305.8 g/mol. Its structure includes a chloroindole moiety and a pyridine ring, which contribute to its high affinity and selectivity for the 5-HT2C receptor.

References[edit]

This medical article is a stub. You can help WikiMD by expanding the page.